For research use only. Not for therapeutic Use.
ERD03（Cat No.:I026976）is a small-molecule antagonist of the orexin-1 receptor (OX1R), a G protein-coupled receptor involved in regulating arousal, reward, and stress responses. By selectively inhibiting OX1R, ERD03 blocks orexin-A–mediated signaling, offering potential therapeutic benefits in conditions such as anxiety, addiction, and sleep disorders. It does not significantly affect orexin-2 receptor (OX2R), which is more involved in sleep-wake regulation, thereby allowing selective modulation of emotional and behavioral pathways. ERD03 is a valuable pharmacological tool for studying orexin biology and developing treatments targeting neuropsychiatric and stress-related conditions.
| CAS Number | 1377897-01-2 |
| Synonyms | (4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(3-hydroxy-3-methylbutyl)phenyl]methanone |
| Molecular Formula | C21H25NO3 |
| Purity | ≥95% |
| IUPAC Name | (4-hydroxy-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(3-hydroxy-3-methylbutyl)phenyl]methanone |
| InChI | InChI=1S/C21H25NO3/c1-21(2,25)11-10-15-6-5-8-16(12-15)20(24)22-13-17-7-3-4-9-18(17)19(23)14-22/h3-9,12,19,23,25H,10-11,13-14H2,1-2H3 |
| InChIKey | HYVUFYJZMRRTOP-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC1=CC(=CC=C1)C(=O)N2CC(C3=CC=CC=C3C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
