For research use only. Not for therapeutic Use.
Erastin2（Cat No.:I044096）is a potent analog of Erastin, known for inducing ferroptosis, a regulated form of iron-dependent, non-apoptotic cell death characterized by lipid peroxidation. It inhibits the system Xc⁻ cystine/glutamate antiporter, leading to glutathione depletion and inactivation of GPX4, a key antioxidant enzyme. Erastin2 exhibits improved potency and metabolic stability compared to its predecessor, making it a valuable tool in studying redox biology, cancer metabolism, and cell death mechanisms. It is widely used in ferroptosis research to explore vulnerabilities in therapy-resistant tumors and to develop novel anticancer strategies.
| CAS Number | 1695533-44-8 |
| Synonyms | 2-[[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]methyl]-3-(5-phenyl-2-propan-2-yloxyphenyl)quinazolin-4-one |
| Molecular Formula | C36H35ClN4O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]methyl]-3-(5-phenyl-2-propan-2-yloxyphenyl)quinazolin-4-one |
| InChI | InChI=1S/C36H35ClN4O4/c1-25(2)45-33-17-12-27(26-8-4-3-5-9-26)22-32(33)41-34(38-31-11-7-6-10-30(31)36(41)43)23-39-18-20-40(21-19-39)35(42)24-44-29-15-13-28(37)14-16-29/h3-17,22,25H,18-21,23-24H2,1-2H3 |
| InChIKey | WLPHOTYCGOGILE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C2=CC=CC=C2)N3C(=NC4=CC=CC=C4C3=O)CN5CCN(CC5)C(=O)COC6=CC=C(C=C6)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
