Equilenin is a naturally occurring estrogenic steroid hormone found in the urine of pregnant mares. It is widely used in hormone replacement therapy (HRT) and pharmaceutical research due to its potent estrogenic activity. This compound is essential for studying the effects of estrogen on various physiological processes and developing treatments for menopausal symptoms and osteoporosis. Equilenin’s high purity and biological activity ensure reliable research outcomes, making it a critical component in advanced endocrinological and pharmaceutical applications.
Catalog Number | R052468 |
CAS Number | 517-09-9 |
Synonyms | 3-Hydroxyestra-1,3,5,7,9-pentaen-17-one; (+)-Equilenin; 3-Hydroxyestra-1,3,5(10),6,8-pentaen-17-one; E 400; Equilenine; NSC 9901; d-Equilenin; |
Molecular Formula | C18H18O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (13S,14S)-3-hydroxy-13-methyl-12,14,15,16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one |
InChI | InChI=1S/C18H18O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h2-5,10,16,19H,6-9H2,1H3/t16-,18-/m0/s1 |
InChIKey | PDRGHUMCVRDZLQ-WMZOPIPTSA-N |
SMILES | CC12CCC3=C(C1CCC2=O)C=CC4=C3C=CC(=C4)O |