For research use only. Not for therapeutic Use.
Enprofylline（Cat No.:R064126）is a xanthine derivative and bronchodilator that acts primarily as a selective adenosine receptor antagonist with minimal phosphodiesterase inhibition. Unlike theophylline, it has reduced cardiac stimulant effects, making it potentially safer for certain patients. Enprofylline improves airflow by relaxing bronchial smooth muscles and reducing airway hyperresponsiveness, making it useful in the management of asthma and chronic obstructive pulmonary disease (COPD). Additionally, its adenosine-blocking properties have been investigated for potential benefits in neurological and inflammatory conditions. It remains a valuable compound in pharmacological research on respiratory and adenosine-mediated pathophysiological mechanisms.
| CAS Number | 41078-02-8 |
| Synonyms | 3-propyl-7H-purine-2,6-dione |
| Molecular Formula | C8H10N4O2 |
| Purity | ≥95% |
| IUPAC Name | 3-propyl-7H-purine-2,6-dione |
| InChI | InChI=1S/C8H10N4O2/c1-2-3-12-6-5(9-4-10-6)7(13)11-8(12)14/h4H,2-3H2,1H3,(H,9,10)(H,11,13,14) |
| InChIKey | SIQPXVQCUCHWDI-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C(=O)NC1=O)NC=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
