For research use only. Not for therapeutic Use.
Enpp-1-IN-19(CAT: I040576) is a potent and selective inhibitor of ectonucleotide pyrophosphatase/phosphodiesterase 1 (ENPP1), an enzyme involved in the hydrolysis of extracellular nucleotides. By targeting ENPP1, Enpp-1-IN-19 disrupts the breakdown of cGAMP, thereby enhancing STING (stimulator of interferon genes) pathway activation and promoting innate immune responses. This mechanism positions Enpp-1-IN-19 as a valuable compound for studying immune modulation and antitumor immunity. Preclinical studies suggest its potential in cancer immunotherapy, particularly in overcoming immunosuppression within the tumor microenvironment. Enpp-1-IN-19 serves as a useful research tool for exploring ENPP1 biology and the development of STING-targeted therapeutic strategies.
| CAS Number | 2738583-25-8 |
| Synonyms | 2-methyl-1-oxo-4-[[4-(sulfamoylamino)phenyl]methyl]phthalazine |
| Molecular Formula | C16H16N4O3S |
| Purity | ≥95% |
| IUPAC Name | 2-methyl-1-oxo-4-[[4-(sulfamoylamino)phenyl]methyl]phthalazine |
| InChI | InChI=1S/C16H16N4O3S/c1-20-16(21)14-5-3-2-4-13(14)15(18-20)10-11-6-8-12(9-7-11)19-24(17,22)23/h2-9,19H,10H2,1H3,(H2,17,22,23) |
| InChIKey | ZBMUKGSKMVACJQ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2C(=N1)CC3=CC=C(C=C3)NS(=O)(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
