For research use only. Not for therapeutic Use.
EN523（Cat No.:I044063）is a potent covalent ligand known for selectively targeting cysteine residues in proteins, especially within the proteome. This compound is a small-molecule electrophile commonly used in chemoproteomic studies to identify reactive cysteines and investigate protein function through covalent modification. EN523 is particularly useful in drug discovery, including the development of covalent inhibitors. Its specificity and reactivity make it a valuable tool in profiling protein targets and mapping ligandable hotspots in cellular systems. EN523 is a key reagent for advancing targeted covalent therapeutics and functional proteomics research.
| CAS Number | 2094893-05-5 |
| Synonyms | 1-(5-methylfuran-2-yl)-4-prop-2-enoylpiperazin-2-one |
| Molecular Formula | C12H14N2O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(5-methylfuran-2-yl)-4-prop-2-enoylpiperazin-2-one |
| InChI | InChI=1S/C12H14N2O3/c1-3-10(15)13-6-7-14(11(16)8-13)12-5-4-9(2)17-12/h3-5H,1,6-8H2,2H3 |
| InChIKey | KYXPDOMFYBFXKO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)N2CCN(CC2=O)C(=O)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
