For research use only. Not for therapeutic Use.
EN450(CAT: I040868) is a cysteine-reactive covalent molecular glue degrader that targets NF-κB, a key regulator in immune response and inflammation. It specifically interacts with the allosteric cysteine residue (C111) in the E2 ubiquitin ligase UBE2D, facilitating the formation of a ternary complex between UBE2D and NF-κB1. This interaction promotes the ubiquitination and subsequent degradation of NF-κB1 via the Cullin E3 ligase complex and the proteasome. EN450 exhibits potent anti-proliferative effects by disrupting NF-κB signaling, which plays a crucial role in cancer cell survival, inflammation, and immune regulation, making it a promising candidate in Cancer Disease Research.
CAS Number | 793719-01-4 |
Synonyms | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]prop-2-enamide |
Molecular Formula | C11H13ClN2O3S |
Purity | ≥95% |
IUPAC Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]prop-2-enamide |
InChI | InChI=1S/C11H13ClN2O3S/c1-4-11(15)13-10-7-8(5-6-9(10)12)18(16,17)14(2)3/h4-7H,1H2,2-3H3,(H,13,15) |
InChIKey | OXFXDOLAQBMOPH-UHFFFAOYSA-N |
SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)Cl)NC(=O)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |