For research use only. Not for therapeutic Use.
Emideltide(CAT: I014352) is a synthetic peptide under investigation for its therapeutic potential in treating mitochondrial diseases and disorders related to oxidative stress. Emideltide is designed to mimic or enhance the natural functions of certain proteins involved in mitochondrial health, aiming to restore or improve cellular energy production in conditions where mitochondria are dysfunctional. By targeting the mitochondria, Emideltide may help reduce oxidative damage, improve cellular metabolism, and support overall mitochondrial function, making it a candidate for therapies aimed at neurodegenerative diseases, metabolic disorders, and age-related conditions. Its precise mechanism of action and therapeutic efficacy are subjects of ongoing research, with the hope of developing new treatments for conditions with limited options.
| CAS Number | 62568-57-4 |
| Synonyms | Emideltide; DSIP nonapeptide;;L-tryptophyl-L-alanylglycylglycyl-L-aspartyl-L-alanyl-L-serylglycyl-L-glutamic acid |
| Molecular Formula | C35H48N10O15 |
| Purity | ≥95% |
| Target | SOD |
| Solubility | Soluble in DMSO |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoyl]amino]acetyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]propanoyl]amino]-3-hydroxypropanoyl]amino]acetyl]amino]pentanedioic acid |
| InChI | InChI=1S/C35H48N10O15/c1-16(41-32(56)20(36)9-18-11-37-21-6-4-3-5-19(18)21)30(54)39-12-25(47)38-13-26(48)44-23(10-29(52)53)34(58)42-17(2)31(55)45-24(15-46)33(57)40-14-27(49)43-22(35(59)60)7-8-28(50)51/h3-6,11,16-17,20,22-24,37,46H,7-10,12-15,36H2,1-2H3,(H,38,47)(H,39,54)(H,40,57)(H,41,56)(H,42,58)(H,43,49)(H,44,48)(H,45,55)(H,50,51)(H,52,53)(H,59,60)/t16-,17-,20-,22-,23-,24-/m0/s1 |
| InChIKey | ZRZROXNBKJAOKB-GFVHOAGBSA-N |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(CNC([C@H](CO)NC([C@H](C)NC([C@H](CC(O)=O)NC(CNC(CNC([C@H](C)NC([C@H](CC1=CNC2=C1C=CC=C2)N)=O)=O)=O)=O)=O)=O)=O)=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |