For research use only. Not for therapeutic Use.
EMI56（Cat No.:I015150）is a small-molecule inhibitor developed to selectively modulate mitochondrial function and cellular energy metabolism. By targeting key enzymatic pathways involved in oxidative phosphorylation, EMI56 helps regulate ATP production, redox balance, and reactive oxygen species generation. This compound has drawn attention in biomedical research for its potential applications in studying metabolic diseases, neurodegeneration, and cancer, where mitochondrial dysfunction plays a central role. Its pharmacological profile suggests utility as both a research tool and a possible therapeutic lead in disorders linked to energy dysregulation and oxidative stress.
| CAS Number | 2414374-41-5 |
| Synonyms | 3-(1,3-benzoxazol-2-yl)-7-(diethylamino)-6-methylchromen-2-one |
| Molecular Formula | C21H20N2O3 |
| Purity | ≥95% |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-7-(diethylamino)-6-methylchromen-2-one |
| InChI | InChI=1S/C21H20N2O3/c1-4-23(5-2)17-12-19-14(10-13(17)3)11-15(21(24)26-19)20-22-16-8-6-7-9-18(16)25-20/h6-12H,4-5H2,1-3H3 |
| InChIKey | OYQNORRYAWXDHW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1C)C=C(C(=O)O2)C3=NC4=CC=CC=C4O3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
