For research use only. Not for therapeutic Use.
EMD386088（Cat No.:I006652）is a selective small molecule inhibitor that targets the protein kinase CK1 (casein kinase 1), a key enzyme involved in various cellular processes, including the regulation of the Wnt signaling pathway. By inhibiting CK1, EMD386088 has the potential to modulate cellular growth and differentiation, making it a promising candidate in cancer therapy and other diseases associated with dysregulated Wnt signaling. Early-stage research suggests it may be effective in treating certain cancers and neurological disorders. Further preclinical and clinical studies are needed to evaluate its full therapeutic potential and safety profile.
| CAS Number | 1171123-46-8 |
| Synonyms | 5-chloro-2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole;hydrochloride |
| Molecular Formula | C14H16Cl2N2 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole;hydrochloride |
| InChI | InChI=1S/C14H15ClN2.ClH/c1-9-14(10-4-6-16-7-5-10)12-8-11(15)2-3-13(12)17-9;/h2-4,8,16-17H,5-7H2,1H3;1H |
| InChIKey | WWSNDUWIZDYGIQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)Cl)C3=CCNCC3.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
