<p style="/line-height:25px/">
Emamectin Benzoate(CAS 155569-91-8) works as a chloride channel activator by binding gamma aminobutyric acid (GABA) receptor and glutamate-gated chloride channels disrupting nerve signals within arthropods.<br />
Target: GABA Receptor<br />
Emamectin Benzoate stimulates the release of GABA from the synapses between nerve cells and while additionally increasing GABA/'s affinity for its receptor on the post-junction membrane of muscle cells in insects and arthropods.</p>
| Catalog Number | I001973 |
| CAS Number | 155569-91-8 |
| Molecular Formula | C104H154N2O28 |
| Purity | 95% |
| Target | GABA Receptor |
| Solubility | DMSO:31mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | benzoic acid;(1'R,2R,3S,4'S,6S,8'R,10'E,12'S,13'S,14'E,16'E,20'R,21'R,24'S)-2-[(2S)-butan-2-yl]-21',24'-dihydroxy-12'-[(2R,4S,5S,6S)-4-methoxy-5-[(2S,4S,5S,6S)-4-methoxy-6-methyl-5-(methylamino)oxan-2-yl]oxy-6-methyloxan-2-yl]oxy-3,11',13',22'-tetramethylspiro[2,3-dihydropyran-6,6'-3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene]-2'-one |
| InChIKey | GCKZANITAMOIAR-XWVCPFKXSA-N |
| SMILES | CCC(C)C1C(C=CC2(O1)CC3CC(O2)CC=C(C(C(C=CC=C4COC5C4(C(C=C(C5O)C)C(=O)O3)O)C)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)NC)OC)OC)C)C.C1=CC=C(C=C1)C(=O)O |
| Reference | <p style="/line-height:25px/"> |
