For research use only. Not for therapeutic Use.
ELOVL1-IN-1（Cat No.:I045173）is a potent and selective inhibitor of elongation of very long-chain fatty acids protein 1 (ELOVL1), an enzyme responsible for synthesizing saturated and monounsaturated very long-chain fatty acids (VLCFAs) crucial for sphingolipid and ceramide production. By blocking ELOVL1 activity, it reduces VLCFA accumulation implicated in neurodegenerative disorders, metabolic diseases, and certain rare lipid storage conditions. ELOVL1-IN-1 serves as a valuable research tool for studying lipid metabolism, membrane biology, and sphingolipid-related signaling. It holds therapeutic potential for treating VLCFA-associated pathologies, including adrenoleukodystrophy and other peroxisomal or myelin-related disorders.
| CAS Number | 2227482-41-7 |
| Synonyms | 1-(2-fluorophenyl)-N-[1-(2-fluoropyridin-4-yl)pyrazol-3-yl]cyclopropane-1-carboxamide |
| Molecular Formula | C18H14F2N4O |
| Purity | ≥95% |
| IUPAC Name | 1-(2-fluorophenyl)-N-[1-(2-fluoropyridin-4-yl)pyrazol-3-yl]cyclopropane-1-carboxamide |
| InChI | InChI=1S/C18H14F2N4O/c19-14-4-2-1-3-13(14)18(7-8-18)17(25)22-16-6-10-24(23-16)12-5-9-21-15(20)11-12/h1-6,9-11H,7-8H2,(H,22,23,25) |
| InChIKey | UWMKZOSESQVNAA-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2F)C(=O)NC3=NN(C=C3)C4=CC(=NC=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
