For research use only. Not for therapeutic Use.
Ellagic acid(Cat No.:A000388)is a natural polyphenol compound found in various fruits and vegetables, such as pomegranates, strawberries, and nuts. Known for its potent antioxidant properties, it neutralizes free radicals and protects cells from oxidative stress. Ellagic acid exhibits anti-inflammatory, anti-carcinogenic, and anti-microbial activities, making it valuable in promoting overall health. Studies suggest it may help in preventing certain cancers, cardiovascular diseases, and neurodegenerative disorders. Its ability to modulate metabolic pathways and support detoxification processes highlights Ellagic acid as a beneficial dietary supplement for enhancing health and wellness.
| CAS Number | 476-66-4 |
| Synonyms | Elagostasine, Gallogen |
| Molecular Formula | C₁₄H₆O₈ |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | 6,7,13,14-tetrahydroxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| InChI | InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H |
| InChIKey | AFSDNFLWKVMVRB-UHFFFAOYSA-N |
| SMILES | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |