For research use only. Not for therapeutic Use.
EGA (Cat No.:R067044), also known as ethyl 2-amino-1,3,4-thiadiazole-5-carboxylate, is a heterocyclic compound featuring a 1,3,4-thiadiazole core. This structure is of interest in medicinal and pharmaceutical chemistry due to its potential biological activities, including antimicrobial, anti-inflammatory, and anticancer properties. EGA serves as a valuable building block in the synthesis of bioactive molecules and drug candidates. Its carboxylate and amino functional groups provide reactive sites for further derivatization, making it versatile for research and development. EGA is primarily used in preclinical studies and chemical biology investigations.
| CAS Number | 415687-81-9 |
| Synonyms | 1-[(E)-(4-bromophenyl)methylideneamino]-3-(2,6-dimethylphenyl)urea |
| Molecular Formula | C16H16BrN3O |
| Purity | ≥95% |
| IUPAC Name | 1-[(E)-(4-bromophenyl)methylideneamino]-3-(2,6-dimethylphenyl)urea |
| InChI | InChI=1S/C16H16BrN3O/c1-11-4-3-5-12(2)15(11)19-16(21)20-18-10-13-6-8-14(17)9-7-13/h3-10H,1-2H3,(H2,19,20,21)/b18-10+ |
| InChIKey | QVNLLEFLGISSAQ-VCHYOVAHSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)N/N=C/C2=CC=C(C=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
