For research use only. Not for therapeutic Use.
Efinaconazole-N-oxide (Cat No.:C000651) is a derivative of efinaconazole, an antifungal medication used topically to treat fungal nail infections. The addition of an N-oxide group introduces an oxygen atom into the molecule, potentially influencing its pharmacological properties. Efinaconazole functions by inhibiting fungal ergosterol synthesis, disrupting cell membrane integrity.
| CAS Number | 2055038-63-4 |
| Synonyms | (αR,βR)-α-(2,4-Difluorophenyl)-β-methyl-4-methylene-α-(1H-1,2,4-triazol-1-ylmethyl)-1-piperidineethanol 1-Oxide; 1-((2R,3R)-3-(2,4-Difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-1-yl)butan-2-yl)-4-methylenepiperidine 1-Oxide; |
| Molecular Formula | C₁₈H₂₂F₂N₄O₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | (2R,3R)-2-(2,4-difluorophenyl)-3-(4-methylidene-1-oxidopiperidin-1-ium-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChI | InChI=1S/C18H22F2N4O2/c1-13-5-7-24(26,8-6-13)14(2)18(25,10-23-12-21-11-22-23)16-4-3-15(19)9-17(16)20/h3-4,9,11-12,14,25H,1,5-8,10H2,2H3/t14-,18-/m1/s1 |
| InChIKey | QARBKVDEPDEZCY-RDTXWAMCSA-N |
| SMILES | CC(C(CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)[N+]3(CCC(=C)CC3)[O-] |
| Reference | Sugiura, K., et. al.: Antimicrob. Agents CH., 58, 3837 (2014); |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |