For research use only. Not for therapeutic Use.
Edoxaban Impurity 4（Cat No.:I044551）is a structurally related byproduct or degradation product formed during the synthesis or storage of edoxaban, a direct oral anticoagulant targeting factor Xa. Monitoring this impurity is essential for ensuring the purity, safety, and efficacy of the pharmaceutical product. It is typically identified and quantified using advanced analytical techniques such as HPLC, LC-MS, or NMR. Studying Edoxaban Impurity 4 helps in understanding the stability profile and optimizing manufacturing conditions. Regulatory guidelines require stringent control of such impurities to meet quality standards and ensure patient safety.
| CAS Number | 480452-36-6 |
| Synonyms | tert-butyl N-[(1R,2S,5S)-2-[[2-[(5-chloropyridin-2-yl)amino]-2-oxoacetyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate |
| Molecular Formula | C21H30ClN5O5 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl N-[(1R,2S,5S)-2-[[2-[(5-chloropyridin-2-yl)amino]-2-oxoacetyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate |
| InChI | InChI=1S/C21H30ClN5O5/c1-21(2,3)32-20(31)25-15-10-12(19(30)27(4)5)6-8-14(15)24-17(28)18(29)26-16-9-7-13(22)11-23-16/h7,9,11-12,14-15H,6,8,10H2,1-5H3,(H,24,28)(H,25,31)(H,23,26,29)/t12-,14-,15+/m0/s1 |
| InChIKey | YJDLJNAWLBVIRF-AEGPPILISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@@H]1NC(=O)C(=O)NC2=NC=C(C=C2)Cl)C(=O)N(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
