Edaravone-d5（Cat No.:I017451 ） is a deuterated version of Edaravone, where five hydrogen atoms are replaced with deuterium. This isotopic enhancement increases molecular stability, making it a pivotal tool for pharmacokinetic and metabolic studies, particularly in neurological research. Edaravone-d5 is extensively used to explore its protective effects against oxidative stress and neurodegenerative conditions like amyotrophic lateral sclerosis (ALS). Its application in trace analysis and molecular tracking helps refine therapeutic strategies and enhance drug delivery systems.
| Catalog Number | I017451 |
| CAS Number | 1228765-67-0 |
| Molecular Formula | C₁₀H₅D₅N₂O |
| Purity | 95% |
| IUPAC Name | 5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-4H-pyrazol-3-one |
| InChI | InChI=1S/C10H10N2O/c1-8-7-10(13)12(11-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3/i2D,3D,4D,5D,6D |
| InChIKey | QELUYTUMUWHWMC-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N2C(=O)CC(=N2)C)[2H])[2H] |
