For research use only. Not for therapeutic Use.
Eciruciclib（Cat No.:I045113）is an investigational oral cyclin-dependent kinase (CDK) inhibitor, primarily targeting CDK2, CDK4, and CDK6, which are essential regulators of cell cycle progression. By inhibiting these kinases, Eciruciclib disrupts the G1 to S phase transition, leading to cell cycle arrest and reduced tumor proliferation. It is being developed for the treatment of various cancers, including hormone receptor–positive breast cancer and other solid tumors. Eciruciclib may also enhance the effectiveness of endocrine therapies. Supplied for research into cell cycle regulation, CDK inhibition, and targeted cancer therapeutics.
| CAS Number | 1868086-40-1 |
| Synonyms | N-[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]-5-fluoro-4-(2-methyl-3-propan-2-ylindazol-5-yl)pyrimidin-2-amine |
| Molecular Formula | C27H33FN8 |
| Purity | ≥95% |
| IUPAC Name | N-[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]-5-fluoro-4-(2-methyl-3-propan-2-ylindazol-5-yl)pyrimidin-2-amine |
| InChI | InChI=1S/C27H33FN8/c1-5-35-10-12-36(13-11-35)17-19-6-9-24(29-15-19)31-27-30-16-22(28)25(32-27)20-7-8-23-21(14-20)26(18(2)3)34(4)33-23/h6-9,14-16,18H,5,10-13,17H2,1-4H3,(H,29,30,31,32) |
| InChIKey | RLRQXKXWZNPYRB-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=CN=C(C=C2)NC3=NC=C(C(=N3)C4=CC5=C(N(N=C5C=C4)C)C(C)C)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
