For research use only. Not for therapeutic Use.
E3 ligase Ligand-Linker Conjugates 18 (Cat.No:I013186) is a synthesized compound that incorporates an E3 ligase ligand and a linker used in PROTAC technology.
| CAS Number | 2098488-36-7 |
| Molecular Formula | C₁₉H₂₀N₆O₆ |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO |
| IUPAC Name | N-(4-azidobutyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide |
| InChI | InChI=1S/C19H20N6O6/c20-24-22-9-2-1-8-21-15(27)10-31-13-5-3-4-11-16(13)19(30)25(18(11)29)12-6-7-14(26)23-17(12)28/h3-5,12H,1-2,6-10H2,(H,21,27)(H,23,26,28) |
| InChIKey | USWFAZSQVLTHHA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCC(=O)NCCCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |