For research use only. Not for therapeutic Use.
E3 Ligase Ligand 18（Cat No.:I017770）is a small-molecule ligand that selectively binds to E3 ubiquitin ligases, enabling targeted protein degradation strategies such as PROTAC (Proteolysis Targeting Chimera) development. By recruiting specific E3 ligases to a protein of interest, it facilitates ubiquitination and subsequent proteasomal degradation. The ligand incorporates optimized binding motifs for high affinity and stability, making it a valuable tool in chemical biology and drug discovery. E3 Ligase Ligand 18 supports the design of next-generation therapeutics, offering precise control over protein homeostasis and selective modulation of disease-associated targets.
| CAS Number | 2241669-88-3 |
| Synonyms | (2R)-2-acetamido-3-[[2-amino-9-[(4-chlorophenyl)methyl]-6-oxo-1H-purin-8-yl]sulfanyl]propanoic acid |
| Molecular Formula | C17H17ClN6O4S |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-acetamido-3-[[2-amino-9-[(4-chlorophenyl)methyl]-6-oxo-1H-purin-8-yl]sulfanyl]propanoic acid |
| InChI | InChI=1S/C17H17ClN6O4S/c1-8(25)20-11(15(27)28)7-29-17-21-12-13(22-16(19)23-14(12)26)24(17)6-9-2-4-10(18)5-3-9/h2-5,11H,6-7H2,1H3,(H,20,25)(H,27,28)(H3,19,22,23,26)/t11-/m0/s1 |
| InChIKey | CEOFSRBWEZNKGM-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CSC1=NC2=C(N1CC3=CC=C(C=C3)Cl)N=C(NC2=O)N)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
