Home
>
Chemical Reagents>Organic Building Blocks> (E)-N'-((1H-Indol-6-yl)methylene)-2-(2-(tetrahydro-2H-pyran-4-yl)-4,6-dimethylphenoxy)acetohydrazide
(E)-N'-((1H-Indol-6-yl)methylene)-2-(2-(tetrahydro-2H-pyran-4-yl)-4,6-dimethylphenoxy)acetohydrazide
For research use only. Not for therapeutic Use.
(E)-N’-((1H-Indol-6-yl)methylene)-2-(2-(tetrahydro-2H-pyran-4-yl)-4,6-dimethylphenoxy)acetohydrazide(Cat No.:L029127)is a complex and specialized compound used in advanced pharmaceutical research and organic synthesis. Combining an indole core with a methylene hydrazide linkage and a substituted phenoxy group, this compound is valuable in the development of bioactive molecules, including potential therapeutic agents. Its intricate structure allows for diverse chemical transformations, making it a crucial intermediate in medicinal chemistry. High purity and consistent performance ensure reliable results in research aimed at innovative drug discovery and development.
| CAS Number | 1572184-68-9 |
| Molecular Formula | C24H27N3O3 |
| Purity | ≥95% |
| IUPAC Name | 2-[2,4-dimethyl-6-(oxan-4-yl)phenoxy]-N-[(E)-1H-indol-6-ylmethylideneamino]acetamide |
| InChI | InChI=1S/C24H27N3O3/c1-16-11-17(2)24(21(12-16)19-6-9-29-10-7-19)30-15-23(28)27-26-14-18-3-4-20-5-8-25-22(20)13-18/h3-5,8,11-14,19,25H,6-7,9-10,15H2,1-2H3,(H,27,28)/b26-14+ |
| InChIKey | GKDSQRIJIGRMRV-VULFUBBASA-N |
| SMILES | CC1=CC(=C(C(=C1)C2CCOCC2)OCC(=O)NN=CC3=CC4=C(C=C3)C=CN4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |