For research use only. Not for therapeutic Use.
(-)-(E)-Guggulsterone（Cat No.:R072736）is a naturally occurring plant sterol derived from the resin of Commiphora mukul (guggul), traditionally used in Ayurvedic medicine. It functions as an antagonist of the farnesoid X receptor (FXR), a nuclear receptor involved in bile acid and cholesterol metabolism. By modulating FXR activity, (-)-(E)-Guggulsterone influences lipid homeostasis, potentially lowering cholesterol levels and supporting cardiovascular health. Additionally, it exhibits anti-inflammatory, antioxidant, and anticancer properties, making it a subject of interest in metabolic and therapeutic research. Its multifaceted bioactivity positions it as a promising compound for drug development and disease modulation.
| CAS Number | 39025-24-6 |
| Synonyms | (8R,9S,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione |
| Molecular Formula | C21H28O2 |
| Purity | ≥95% |
| IUPAC Name | (8R,9S,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione |
| InChI | InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4-/t15-,17+,18+,20+,21-/m1/s1 |
| InChIKey | WDXRGPWQVHZTQJ-AUKWTSKRSA-N |
| SMILES | C/C=C\1/C(=O)C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
