(E)-β-Farnesene（Cat No.:M087376） possesses several advantages, including no sulfur content, high cetane number (a measure of diesel fuel’s ignition quality), excellent low-temperature performance, and low greenhouse gas (GHG) emissions. As a bio-based chemical, it finds diverse applications and exhibits ideal effects. Its unique properties make it a promising alternative to conventional petroleum-derived fuels and chemicals, offering environmentally-friendly solutions in the energy and chemical industries while contributing to the reduction of greenhouse gas emissions.
| Catalog Number | M087376 |
| CAS Number | 18794-84-8 |
| Molecular Formula | C15H24 |
| Purity | 95% |
| Storage | Store at −20°C |
| IUPAC Name | (6E)-7,11-dimethyl-3-methylidenedodeca-1,6,10-triene |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+ |
| InChIKey | JSNRRGGBADWTMC-NTCAYCPXSA-N |
| SMILES | CC(=CCCC(=CCCC(=C)C=C)C)C |
