For research use only. Not for therapeutic Use.
| CAS Number | 15690-25-2 |
| Synonyms | (E)-3-(Thiophen-2-yl)-2-propenoic Acid; (E)-3-(Thiophen-2-yl)acrylic Acid; trans-3-Thiopheneacrylic Acid; (E)-2-Thiopheneacrylic Acid; (E)-3-(2-Thienyl)-2-propenoic Acid; |
| Molecular Formula | C7H6O2S |
| Purity | ≥95% |
| Storage | Store at +4°C |
| IUPAC Name | (E)-3-thiophen-2-ylprop-2-enoic acid |
| InChI | InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/b4-3+ |
| InChIKey | KKMZQOIASVGJQE-ONEGZZNKSA-N |
| SMILES | C1=CSC(=C1)C=CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |