For research use only. Not for therapeutic Use.
E-(2-Ethoxy-propenyl)-triphenyl-phosphonium iodide salt(Cat No.:M020363) is a specialized chemical compound featuring a phosphonium ion, a functional group known for its stability and reactivity in organic synthesis. This compound consists of a phosphonium core bonded to three phenyl groups and an ethoxy-propenyl group, with an iodide ion serving as the counterion. Such structure makes it highly useful in Wittig reactions, a common method for forming carbon-carbon double bonds in synthetic organic chemistry. Its applications extend to the synthesis of complex organic molecules, particularly in the pharmaceutical and materials science industries.
| CAS Number | 119352-07-7 |
| Synonyms | E-(2-ETHOXY-PROPENYL)-TRIPHENYL-PHOSPHONIUM IODIDE SALT |
| Molecular Formula | C23H24IOP |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(E)-2-ethoxyprop-1-enyl]-triphenylphosphanium;iodide |
| InChI | InChI=1S/C23H24OP.HI/c1-3-24-20(2)19-25(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23;/h4-19H,3H2,1-2H3;1H/q+1;/p-1/b20-19+; |
| InChIKey | USVXHKAXMCEZRL-RZLHGTIFSA-M |
| SMILES | CCOC(=C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C.[I-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |