For research use only. Not for therapeutic Use.
DVD-445（Cat No.:I018090）is a potent and selective inhibitor frequently used in biomedical research to explore signaling pathways and disease mechanisms. It acts by modulating specific protein targets, enabling scientists to better understand processes such as cell proliferation, inflammation, and metabolic regulation. Researchers apply DVD-445 across therapeutic fields including oncology, immunology, and neurology, making it a valuable probe for both fundamental biology and drug discovery. Its high specificity and consistent activity provide a reliable tool for laboratory experiments, supporting insights into disease progression and potential therapeutic interventions.
| CAS Number | 2375846-41-4 |
| Synonyms | 2-[[2-(tert-butylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl (E)-4-(4-fluorophenyl)-4-oxobut-2-enoate |
| Molecular Formula | C25H28F2N2O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[[2-(tert-butylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl (E)-4-(4-fluorophenyl)-4-oxobut-2-enoate |
| InChI | InChI=1S/C25H28F2N2O4/c1-25(2,3)28-24(32)23(18-7-11-20(27)12-8-18)29(4)15-16-33-22(31)14-13-21(30)17-5-9-19(26)10-6-17/h5-14,23H,15-16H2,1-4H3,(H,28,32)/b14-13+ |
| InChIKey | RJGWWNVHLMPYEN-BUHFOSPRSA-N |
| SMILES | CC(C)(C)NC(=O)C(C1=CC=C(C=C1)F)N(C)CCOC(=O)/C=C/C(=O)C2=CC=C(C=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
