For research use only. Not for therapeutic Use.
DSG-PEG (MW 2000)(CAT: I040644) is a bifunctional polyethylene glycol derivative featuring disuccinimidyl glutarate (DSG) reactive groups at both ends of a PEG chain with a molecular weight of 2000 Da. The NHS ester groups enable efficient and specific conjugation to primary amines, commonly found on proteins, peptides, and other biomolecules. DSG-PEG is widely used in bioconjugation, drug delivery systems, and surface modification to improve solubility, reduce immunogenicity, and enhance pharmacokinetics. Its hydrophilic PEG spacer provides flexibility and spacing between functional entities, making it valuable for antibody-drug conjugates, nanoparticle stabilization, and therapeutic payload delivery.
| CAS Number | 308805-39-2 |
| Molecular Formula | C42H82O6 |
| Purity | ≥95% |
| IUPAC Name | methane;[3-(2-methoxyethoxy)-2-octadecanoyloxypropyl] octadecanoate |
| InChI | InChI=1S/C42H82O6/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-41(43)47-39-40(38-46-37-36-45-3)48-42(44)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h40H,4-39H2,1-3H3 |
| InChIKey | NCSNIEUPEZYVMN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(COCCOC)OC(=O)CCCCCCCCCCCCCCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |