For research use only. Not for therapeutic Use.
Drupanin（Cat No.:I043806）is a bioactive peptide known for its role in regulating metabolic processes. Found in certain plant species, it has demonstrated antioxidant and anti-inflammatory properties. Drupanin is being researched for its potential therapeutic effects, particularly in the context of metabolic diseases, including obesity and type 2 diabetes. It may help modulate insulin sensitivity and improve lipid metabolism. Due to its natural origin and promising bioactivity, Drupanin is gaining attention in both metabolic health and pharmaceutical research, though further clinical studies are needed to confirm its efficacy.
| CAS Number | 53755-58-1 |
| Synonyms | (E)-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| Molecular Formula | C14H16O3 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| InChI | InChI=1S/C14H16O3/c1-10(2)3-6-12-9-11(4-7-13(12)15)5-8-14(16)17/h3-5,7-9,15H,6H2,1-2H3,(H,16,17)/b8-5+ |
| InChIKey | HZKNHDLUFBYIQN-VMPITWQZSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)/C=C/C(=O)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
