For research use only. Not for therapeutic Use.
DPTN dihydrochloride（Cat No.:I041179）is a chemical compound used primarily in scientific research, particularly in the fields of molecular biology and pharmacology. It acts as a potent inhibitor of specific enzymes involved in various biochemical pathways. Studies have shown that DPTN dihydrochloride may have potential therapeutic applications, particularly in cancer and inflammation-related diseases. It is also being explored for its ability to modulate immune responses, offering insights into immune system regulation. Ongoing research aims to evaluate its safety, efficacy, and broader applicability in clinical settings for disease treatment.
| CAS Number | 325767-87-1 |
| Synonyms | N-[4-(3,5-dimethylphenyl)-5-pyridin-4-yl-1,3-thiazol-2-yl]pyridine-3-carboxamide;dihydrochloride |
| Molecular Formula | C22H20Cl2N4OS |
| Purity | ≥95% |
| IUPAC Name | N-[4-(3,5-dimethylphenyl)-5-pyridin-4-yl-1,3-thiazol-2-yl]pyridine-3-carboxamide;dihydrochloride |
| InChI | InChI=1S/C22H18N4OS.2ClH/c1-14-10-15(2)12-18(11-14)19-20(16-5-8-23-9-6-16)28-22(25-19)26-21(27)17-4-3-7-24-13-17;;/h3-13H,1-2H3,(H,25,26,27);2*1H |
| InChIKey | GTWKWBXTCBUKTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=C(SC(=N2)NC(=O)C3=CN=CC=C3)C4=CC=NC=C4)C.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
