For research use only. Not for therapeutic Use.
DOTMA (Cat No.:I026474) is a cationic lipid commonly used in liposome and lipoplex formulations for gene delivery. Its structure includes a positively charged quaternary ammonium headgroup and two unsaturated oleyl chains, allowing it to form stable complexes with negatively charged nucleic acids such as DNA or RNA. DOTMA facilitates cellular uptake and endosomal escape of genetic material, making it a valuable component in transfection reagents and non-viral gene therapy systems. It is widely used in molecular biology and pharmaceutical research for efficient and reproducible nucleic acid delivery.
| CAS Number | 104872-42-6 |
| Synonyms | 2,3-bis[(E)-octadec-9-enoxy]propyl-trimethylazanium;chloride |
| Molecular Formula | C42H84ClNO2 |
| Purity | ≥95% |
| IUPAC Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium;chloride |
| InChI | InChI=1S/C42H84NO2.ClH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44-41-42(40-43(3,4)5)45-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,42H,6-19,24-41H2,1-5H3;1H/q+1;/p-1/b22-20-,23-21-; |
| InChIKey | LDGWQMRUWMSZIU-LQDDAWAPSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)C)OCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
