For research use only. Not for therapeutic Use.
DOTA (Cat No.:R016824) is a chelating agent commonly used in the field of radiopharmaceuticals. It is a macrocyclic compound that forms stable complexes with metal ions such as gadolinium, yttrium, and various radioisotopes, making it valuable in medical imaging and targeted therapy. DOTA is widely utilized in the development of radiolabeled compounds for positron emission tomography (PET) and single-photon emission computed tomography (SPECT) imaging. Its ability to securely bind metal ions also makes it useful in drug delivery systems, enhancing the targeted treatment of cancer and other diseases.
| CAS Number | 60239-18-1 |
| Synonyms | 1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetraacetic Acid; 1,4,7,10-Tetra(carboxymethyl)-1,4,7,10-tetraazacyclododecane; 1,4,7,10-Tetraazacyclododecane-N,N’,N’’,N’’’-tetraacetic acid; DOTA; NSC 681107; Tetraxetan |
| Molecular Formula | C16H28N4O8 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| InChI | InChI=1S/C16H28N4O8/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | WDLRUFUQRNWCPK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(CCN(CCN1CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |