For research use only. Not for therapeutic Use.
Dopamine D2 receptor antagonist-1(CAT: I017558) is a synthetic small-molecule inhibitor that selectively targets the dopamine D2 receptor (D2R), a key G protein–coupled receptor (GPCR) involved in dopaminergic neurotransmission. By blocking D2R signaling, this compound reduces dopamine-mediated activation of downstream pathways, making it a valuable research tool for exploring neuropsychiatric disorders, movement disorders, and addiction biology. Dopamine D2 receptor antagonist-1 is particularly relevant to studies of schizophrenia, Parkinson’s disease, bipolar disorder, and reward circuitry. Its defined activity profile supports both receptor pharmacology research and the development of next-generation neurotherapeutics targeting dopaminergic signaling imbalances.
| CAS Number | 1055411-77-2 |
| Synonyms | N-cyclobutyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| Molecular Formula | C14H17N3S |
| Purity | ≥95% |
| IUPAC Name | N-cyclobutyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| InChI | InChI=1S/C14H17N3S/c1-2-7-11-10(6-1)12-13(17-9-4-3-5-9)15-8-16-14(12)18-11/h8-9H,1-7H2,(H,15,16,17) |
| InChIKey | ANUJDLRACOBTTB-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N=CN=C3S2)NC4CCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
