Domoic Acid(Cat No.: R056495) is a naturally occurring toxin produced by certain species of marine microalgae, such as Pseudo-nitzschia spp., and causes Amnesic Shellfish Poisoning (ASP) in humans and wildlife when consumed via contaminated shellfish or other seafood. Domoic acid is a potent neurotoxin that can cause damage to the brain and nervous system, leading to symptoms such as vomiting, diarrhea, confusion, seizures, and in severe cases, coma or death.
| Catalog Number | R056495 |
| CAS Number | 14277-97-5 |
| Synonyms | (2S,3S,4S)-2-Carboxy-4-[(1Z,3E,5R)-5-carboxy-1-methyl-1,3-hexadien-1-yl]-3-pyrrolidineacetic Acid; (-)-Domoic Acid; L-Domoic Acid; NSC 288031; |
| Molecular Formula | C15H21NO6 |
| Purity | 95% |
| Target | Kainate Receptors |
| Solubility | Soluble to 50 mM in sterile water |
| Storage | Desiccate at -20°C |
| IUPAC Name | (2S,3S,4S)-4-[(2Z,4E,6R)-6-carboxyhepta-2,4-dien-2-yl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-5,9-11,13,16H,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b5-3+,8-4-/t9-,10+,11-,13+/m1/s1 |
| InChIKey | VZFRNCSOCOPNDB-AOKDLOFSSA-N |
| SMILES | CC(C=CC=C(C)C1CNC(C1CC(=O)O)C(=O)O)C(=O)O |
| Reference | <p> |
