For research use only. Not for therapeutic Use.
DOI hydrochloride (Cat.No:I010596) is a selective serotonin receptor agonist primarily used in scientific research. It specifically targets the 5-HT2A receptor, mimicking the effects of serotonin in the brain. DOI hydrochloride is utilized to study the role of serotonin receptors in various neurological and psychiatric conditions.
| CAS Number | 42203-78-1 |
| Synonyms | Alternative Name: (±)-2,5-Dimethoxy-4-iodoamphetamine hydrochloride |
| Molecular Formula | C11H17ClINO2 |
| Purity | ≥95% |
| Target | 5-HT Receptor |
| Solubility | Soluble to 50 mM in water |
| Storage | Store at RT |
| IUPAC Name | 1-(4-iodo-2,5-dimethoxyphenyl)propan-2-amine;hydrochloride |
| InChI | InChI=1S/C11H16INO2.ClH/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2;/h5-7H,4,13H2,1-3H3;1H |
| InChIKey | QVFDMWGKHUFODK-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1OC)I)OC)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
