Dodecylguanidine hydrochloride is an organic compound commonly used as an antimicrobial and surfactant agent. It features a long hydrophobic dodecyl (C12) chain attached to a guanidine group, which gives it amphiphilic properties, making it effective in disrupting microbial cell membranes. Its antimicrobial activity is particularly useful in formulations for disinfectants, preservatives, and industrial cleaners. Due to its ability to disrupt lipid bilayers, dodecylguanidine hydrochloride is also employed in research for studying membrane permeability and antimicrobial mechanisms. Its broad-spectrum antimicrobial effects make it valuable in both industrial and research settings.
Catalog Number | M059888 |
CAS Number | 13590-97-1 |
Synonyms | Dodecylguanidine hydrochloride; Dodecylguanidine monohydrochloride |
Molecular Formula | C13H30ClN3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-dodecylguanidine;hydrochloride |
InChI | InChI=1S/C13H29N3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;/h2-12H2,1H3,(H4,14,15,16);1H |
InChIKey | CGMKPKRNUNDACU-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCN=C(N)N.Cl |