For research use only. Not for therapeutic Use.
DNTpD (Cat No.:L022352) is a synthetic analog of natural nucleoside triphosphates, commonly used in molecular biology and antiviral research. Lacking hydroxyl groups at the 2′ and 3′ positions of the sugar moiety, DNTpD terminates DNA strand elongation when incorporated by DNA polymerases. This property makes it essential in techniques such as Sanger sequencing and in the development of antiviral drugs targeting reverse transcriptase enzymes, particularly in HIV treatment. Its structural modifications prevent further chain extension, effectively halting viral replication or aiding precise DNA fragment generation in lab applications.
CAS Number | 199121-98-7 |
Molecular Formula | C64H54N4 |
Purity | ≥95% |
IUPAC Name | 1-N-[4-[4-(N-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]anilino)phenyl]phenyl]-4-N,4-N-bis(3-methylphenyl)-1-N-phenylbenzene-1,4-diamine |
InChI | InChI=1S/C64H54N4/c1-47-15-11-23-61(43-47)67(62-24-12-16-48(2)44-62)59-39-35-57(36-40-59)65(53-19-7-5-8-20-53)55-31-27-51(28-32-55)52-29-33-56(34-30-52)66(54-21-9-6-10-22-54)58-37-41-60(42-38-58)68(63-25-13-17-49(3)45-63)64-26-14-18-50(4)46-64/h5-46H,1-4H3 |
InChIKey | SPDPTFAJSFKAMT-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC=C1)N(C2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)N(C6=CC=CC=C6)C7=CC=C(C=C7)N(C8=CC=CC(=C8)C)C9=CC=CC(=C9)C)C1=CC=CC(=C1)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |