For research use only. Not for therapeutic Use.
DNP-PEG4-Alcohol（Cat No.:I015855）is a bifunctional polyethylene glycol derivative featuring a 2,4-dinitrophenyl (DNP) group and a terminal hydroxyl group, connected by a PEG₄ spacer. The DNP moiety serves as a hapten or antigenic determinant, widely used in immunology studies, antibody production, and assay development. The hydroxyl terminus can be further derivatized or incorporated into conjugation reactions, providing synthetic versatility. The PEG₄ chain enhances water solubility, reduces steric hindrance, and improves biocompatibility. This reagent is particularly valuable for bioconjugation, immunological assay design, and functional material development requiring DNP labeling.
| CAS Number | 1807520-99-5 |
| Synonyms | 2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethanol |
| Molecular Formula | C14H21N3O8 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethanol |
| InChI | InChI=1S/C14H21N3O8/c18-4-6-24-8-10-25-9-7-23-5-3-15-13-2-1-12(16(19)20)11-14(13)17(21)22/h1-2,11,15,18H,3-10H2 |
| InChIKey | MOPINTOOSUROKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCOCCOCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
