For research use only. Not for therapeutic Use.
DNP-NH-PEG2-C2-acid(CAT: I016993) is a bifunctional PEG linker that integrates a dinitrophenyl (DNP) group, a short PEG2 spacer, and a terminal carboxylic acid. The DNP moiety serves as a well-established hapten, often used for antibody recognition, immune response studies, or as a tagging element in bioassays. The PEG2 spacer provides water solubility, molecular flexibility, and reduced steric hindrance, facilitating efficient interactions with biomolecules. The carboxylate terminus allows straightforward conjugation to amines or other reactive groups via standard coupling chemistries. This reagent is valuable for applications in immunology research, targeted delivery systems, and bioconjugation strategies requiring both hapten presentation and chemical versatility.
| CAS Number | 1353011-89-8 |
| Synonyms | 3-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C13H17N3O8 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C13H17N3O8/c17-13(18)3-5-23-7-8-24-6-4-14-11-2-1-10(15(19)20)9-12(11)16(21)22/h1-2,9,14H,3-8H2,(H,17,18) |
| InChIKey | ZZALENBFHFRJPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
