For research use only. Not for therapeutic Use.
DNMT3A-IN-1（Cat No.:I043888）is a small molecule inhibitor that selectively targets DNMT3A, a DNA methyltransferase involved in the addition of methyl groups to DNA. DNMT3A plays a crucial role in epigenetic regulation, and its dysregulation has been implicated in various cancers and developmental disorders. DNMT3A-IN-1 is used in research to study the effects of DNA methylation in gene expression, tumorigenesis, and stem cell differentiation. By inhibiting DNMT3A, this compound helps to uncover the role of DNA methylation in disease mechanisms and potential therapeutic interventions targeting epigenetic alterations.
| CAS Number | 1403598-56-0 |
| Synonyms | 2-cycloheptyl-5-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4,4-dimethylpyrazol-3-one |
| Molecular Formula | C30H38N6O4 |
| Purity | ≥95% |
| IUPAC Name | 2-cycloheptyl-5-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4,4-dimethylpyrazol-3-one |
| InChI | InChI=1S/C30H38N6O4/c1-30(2)27(33-36(29(30)37)23-10-6-4-5-7-11-23)22-14-17-25(38-3)26(20-22)40-19-9-8-18-39-24-15-12-21(13-16-24)28-31-34-35-32-28/h12-17,20,23H,4-11,18-19H2,1-3H3,(H,31,32,34,35) |
| InChIKey | JPXAIORZGBCHIB-UHFFFAOYSA-N |
| SMILES | CC1(C(=NN(C1=O)C2CCCCCC2)C3=CC(=C(C=C3)OC)OCCCCOC4=CC=C(C=C4)C5=NNN=N5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
