For research use only. Not for therapeutic Use.
DMeOB(CAT: I010479) is a potent agonist of the metabotropic glutamate receptor 5 (mGluR5), exhibiting an IC₅₀ value of 3 μM. It plays a dual role by not only activating mGluR5 but also exerting a negative modulatory effect, making it a valuable tool for studying the complex regulatory mechanisms of glutamatergic signaling. DMeOB’s unique pharmacological profile makes it particularly useful in neuroscience research, especially in exploring synaptic plasticity, neurodegenerative diseases, and neuropsychiatric disorders. Its modulatory behavior may provide insights into receptor desensitization and allosteric regulation, aiding in the development of targeted therapeutics for central nervous system disorders.
| CAS Number | 40252-74-2 |
| Synonyms | (E)-1-(3-methoxyphenyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]methanimine |
| Molecular Formula | C16H16N2O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-1-(3-methoxyphenyl)-N-[(E)-(3-methoxyphenyl)methylideneamino]methanimine |
| InChI | InChI=1S/C16H16N2O2/c1-19-15-7-3-5-13(9-15)11-17-18-12-14-6-4-8-16(10-14)20-2/h3-12H,1-2H3/b17-11+,18-12+ |
| InChIKey | FBNPHFBYHYNMHC-JYFOCSDGSA-N |
| SMILES | COC1=CC=CC(=C1)C=NN=CC2=CC(=CC=C2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
