For research use only. Not for therapeutic Use.
DMA-135 hydrochloride（Cat No.:I043966）is a small-molecule antiviral agent that targets the internal ribosome entry site (IRES) of enteroviruses, including enterovirus 71 (EV71), which is linked to hand, foot, and mouth disease and neurological complications. By binding to the IRES RNA, DMA-135 disrupts viral translation initiation, effectively inhibiting viral replication. The hydrochloride salt enhances its solubility and stability for research applications. DMA-135 represents a novel approach in antiviral therapy by targeting viral RNA structures rather than proteins, offering potential for broad-spectrum activity against IRES-dependent viruses with minimal host toxicity.
| CAS Number | 2237925-62-9 |
| Synonyms | 3-amino-N-(diaminomethylidene)-5-(dimethylamino)-6-(2-phenylethynyl)pyrazine-2-carboxamide;hydrochloride |
| Molecular Formula | C16H18ClN7O |
| Purity | ≥95% |
| IUPAC Name | 3-amino-N-(diaminomethylidene)-5-(dimethylamino)-6-(2-phenylethynyl)pyrazine-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C16H17N7O.ClH/c1-23(2)14-11(9-8-10-6-4-3-5-7-10)20-12(13(17)21-14)15(24)22-16(18)19;/h3-7H,1-2H3,(H2,17,21)(H4,18,19,22,24);1H |
| InChIKey | RBMSZKWMVJWPEP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(N=C(C(=N1)N)C(=O)N=C(N)N)C#CC2=CC=CC=C2.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
