For research use only. Not for therapeutic Use.
DL-Tyrosine（Cat No.:I015078）is a racemic mixture of the amino acid tyrosine, containing both D- and L-isomers. As a non-essential aromatic amino acid, it serves as a precursor for catecholamine neurotransmitters (dopamine, norepinephrine, epinephrine), thyroid hormones, and melanin. DL-Tyrosine is widely used in biochemical, neurological, and metabolic research to study neurotransmitter synthesis, stress response, and endocrine regulation. It is also applied in cell culture and protein chemistry as a building block for peptide and protein synthesis. Its versatility makes it valuable in neuroscience, endocrinology, and metabolic studies.
| CAS Number | 556-03-6 |
| Synonyms | 2-amino-3-(4-hydroxyphenyl)propanoic acid |
| Molecular Formula | C9H11NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13) |
| InChIKey | OUYCCCASQSFEME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
