For research use only. Not for therapeutic Use.
DL-Tartaric acid calcium salt(Cat No.:M013470), commonly known as calcium tartrate, is a chemical compound formed by the neutralization of tartaric acid with calcium carbonate or calcium hydroxide. It appears as a white crystalline powder and is slightly soluble in water. This compound is used in various applications including the food industry as an antioxidant and a sequestrant, which helps to stabilize and improve food quality. Additionally, calcium tartrate is used in the pharmaceutical industry as a buffering agent in medications and as a potential source of calcium in dietary supplements.
| CAS Number | 110720-66-6 |
| Molecular Formula | C4H4CaO6· 2H2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | calcium;2,3-dihydroxybutanedioate |
| InChI | InChI=1S/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | GUPPESBEIQALOS-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)(C(=O)[O-])O.[Ca+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |