For research use only. Not for therapeutic Use.
| CAS Number | 34260-70-3 |
| Synonyms | 3-Hydroxy-phenylalanine Methyl Ester Hydrochloride; 2-Amino-3-(3-hydroxyphenyl)propanoic Acid Methyl Ester Hydrochloride; |
| Molecular Formula | C10H14ClNO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChI | InChI=1S/C10H13NO3.ClH/c1-14-10(13)9(11)6-7-3-2-4-8(12)5-7;/h2-5,9,12H,6,11H2,1H3;1H |
| InChIKey | WULJQXTZWBDFSE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)O)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |