For research use only. Not for therapeutic Use.
DL-Laudanosine（Cat No.:M123835）is a quaternary ammonium isoquinoline alkaloid structurally related to neuromuscular blocking agents like atracurium and cisatracurium. It is formed as a metabolite during their breakdown and has been studied for its pharmacological effects. DL-Laudanosine can cross the blood–brain barrier and exhibits central nervous system activity, including potential neuroexcitation and convulsant properties at high concentrations. While not used therapeutically on its own, it is valuable in pharmacological research for understanding drug metabolism, safety profiles of muscle relaxants, and the neurological implications of anesthetic metabolite accumulation.
| CAS Number | 1699-51-0 |
| Synonyms | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
| Molecular Formula | C21H27NO4 |
| Purity | ≥95% |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
| InChI | InChI=1S/C21H27NO4/c1-22-9-8-15-12-20(25-4)21(26-5)13-16(15)17(22)10-14-6-7-18(23-2)19(11-14)24-3/h6-7,11-13,17H,8-10H2,1-5H3 |
| InChIKey | KGPAYJZAMGEDIQ-UHFFFAOYSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
