For research use only. Not for therapeutic Use.
DL-Homocysteine thiolactone-d4 hydrochloride（Cat No.:M072296）is a stable, deuterium-labeled isotopic derivative of homocysteine thiolactone, extensively used as an internal standard in analytical chemistry and biomedical research. The incorporation of deuterium atoms ensures precise quantification and improved accuracy in mass spectrometry-based assays, significantly reducing analytical variability. Researchers leverage this compound primarily in metabolic studies, biomarker validation, and clinical diagnostics involving homocysteine metabolism and related cardiovascular, neurological, and metabolic disorders. Its consistent isotopic profile makes DL-Homocysteine thiolactone-d4 hydrochloride invaluable for accurately monitoring biological processes and developing diagnostic methods targeting homocysteine-associated pathologies.
| CAS Number | 1219805-31-8 |
| Synonyms | 3-amino-4,4,5,5-tetradeuteriothiolan-2-one;hydrochloride |
| Molecular Formula | C4H4D4ClNOS |
| Purity | ≥95% |
| IUPAC Name | 3,4-dideuterio-3-(dideuterioamino)thiolan-2-one;hydrochloride |
| InChI | InChI=1S/C4H7NOS.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/i1D,3D;/hD2 |
| InChIKey | ZSEGSUBKDDEALH-LEUDZYMFSA-N |
| SMILES | [2H]C1CSC(=O)C1([2H])N([2H])[2H].Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
