For research use only. Not for therapeutic Use.
DL-Dihydrozeatin riboside is a synthetic cytokinin, a class of plant growth hormones that regulate cell division, growth, and differentiation. This compound is the riboside form of dihydrozeatin, meaning it has a ribose sugar attached to the hormone, which enhances its solubility and bioavailability in biological systems. Cytokinins like DL-dihydrozeatin riboside are essential for promoting shoot formation, delaying senescence, and influencing various developmental processes in plants. It is widely used in plant biology research to study hormone signaling pathways, growth regulation, and tissue culture practices for promoting the regeneration of plant tissues and organs.
| CAS Number | 22663-55-4 |
| Synonyms | DL-DIHYDROZEATIN RIBOSIDE; DIHYDROZEATIN RIBOSIDE; dihydrozeatin ribosoide; Dihydrozeatin ribonucleoside; N-(4-Hydroxy-3-methylbutyl)adenosine; Ribosyldihydrozeatin; DIHYDROZEATIN RIBOSIDE(DHZR) |
| Molecular Formula | C15H23N5O5 |
| Purity | ≥95% |
| Storage | -20oC |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[(4-hydroxy-3-methylbutyl)amino]purin-9-yl]oxolane-3,4-diol |
| InChI | InChI=1S/C15H23N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h6-9,11-12,15,21-24H,2-5H2,1H3,(H,16,17,18)/t8?,9-,11-,12-,15-/m1/s1 |
| InChIKey | DBVVQDGIJAUEAZ-YXYADJKSSA-N |
| SMILES | CC(CCNC1=NC=NC2=C1N=CN2C3C(C(C(O3)CO)O)O)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |