For research use only. Not for therapeutic Use.
DK1（Cat No.:I044078）is a small-molecule modulator of the Wnt/β-catenin signaling pathway, known for its ability to either activate or inhibit pathway components depending on context and concentration. This pathway plays a crucial role in embryonic development, stem cell regulation, and tumorigenesis. DK1 is commonly used in preclinical research to explore cell fate decisions, cancer biology, and regenerative medicine. By targeting β-catenin activity, DK1 helps delineate the molecular mechanisms underlying Wnt-driven processes, making it a valuable tool for identifying therapeutic targets in diseases such as colorectal cancer and fibrosis.
| CAS Number | 1187568-17-7 |
| Synonyms | 2-(4-chlorophenyl)-7-methoxy-3-methylquinazolin-4-one |
| Molecular Formula | C16H13ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-chlorophenyl)-7-methoxy-3-methylquinazolin-4-one |
| InChI | InChI=1S/C16H13ClN2O2/c1-19-15(10-3-5-11(17)6-4-10)18-14-9-12(21-2)7-8-13(14)16(19)20/h3-9H,1-2H3 |
| InChIKey | XNYBZAGNXXIAKK-UHFFFAOYSA-N |
| SMILES | CN1C(=NC2=C(C1=O)C=CC(=C2)OC)C3=CC=C(C=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
