For research use only. Not for therapeutic Use.
Dithieno[2,3-d:2′,3′-d’]thieno[3,2-b:4,5-b’]dithiophene(Cat No.:M129165), often referred to as DTBDT, is a heterocyclic compound with a unique fused-ring structure. This compound is of interest in organic electronics due to its semiconductor properties, particularly in the field of organic photovoltaics (solar cells) and organic field-effect transistors (OFETs). DTBDT exhibits high charge carrier mobility and good stability, making it a promising material for use in electronic devices. Its complex molecular structure presents challenges in synthesis, requiring specialized techniques to achieve high purity and yield. Research into DTBDT continues to explore its potential applications in advancing organic electronic technologies.
| CAS Number | 124796-79-8 |
| Molecular Formula | C12H4S5 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 3,7,10,13,17-pentathiapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaene |
| InChI | InChI=1S/C12H4S5/c1-3-13-7-5(1)15-11-9(7)17-10-8-6(2-4-14-8)16-12(10)11/h1-4H |
| InChIKey | ALYPESYVXOPFNK-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1SC3=C2SC4=C3SC5=C4SC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |