For research use only. Not for therapeutic Use.
Disperse Blue 73 (Cat No.:M062084) is a synthetic organic dye that belongs to the class of disperse dyes. These dyes are primarily used for coloring synthetic hydrophobic fibers like polyester, acetate, and nylon, as they have poor solubility in water. Disperse Blue 73 is known for its ability to provide various shades of blue, making it popular in the textile industry for dyeing polyester fabrics, including clothing, home textiles, and upholstery. The dyeing process typically involves heating the dye and the fabric together, allowing the dye molecules to penetrate and adhere to the polyester fibers, resulting in vibrant and colorfast textiles.
| CAS Number | 12222-78-5 |
| Molecular Formula | C20H14N2O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,5-diamino-4,8-dihydroxy-2-(4-hydroxyphenyl)anthracene-9,10-dione |
| InChI | InChI=1S/C20H14N2O5/c21-11-5-6-12(24)15-14(11)19(26)16-13(25)7-10(18(22)17(16)20(15)27)8-1-3-9(23)4-2-8/h1-7,23-25H,21-22H2 |
| InChIKey | OXLITIGRBOEDEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C3C(=C2N)C(=O)C4=C(C=CC(=C4C3=O)N)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |